C16H30N6 — CID 143924892
ethane;5-ethanimidoyl-4-N-(1-propan-2-ylpiperidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 143924892) has the molecular formula C16H30N6 and a molecular weight of 306.46 g/mol. Its IUPAC name is ethane;5-ethanimidoyl-4-N-(1-propan-2-ylpiperidin-4-yl)pyrimidine-4,6-diamine.
| Compound Name | ethane;5-ethanimidoyl-4-N-(1-propan-2-ylpiperidin-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 143924892 |
| Molecular Formula | C16H30N6 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | ethane;5-ethanimidoyl-4-N-(1-propan-2-ylpiperidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | CC.[H]/N=C(\C)c1c(N)ncnc1NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C14H24N6.C2H6/c1-9(2)20-6-4-11(5-7-20)19-14-12(10(3)15)13(16)17-8-18-14;1-2/h8-9,11,15H,4-7H2,1-3H3,(H3,16,17,18,19);1-2H3/b15-10+; |
| InChIKey | XEGMZOITHCBULJ-GYVLLFFHSA-N |
| XLogP | 2.76 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|