C26H30F2N2O — CID 143925082
1-[4-[(2,6-difluoro-4-phenylphenoxy)methyl]piperidin-1-yl]-N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimine (PubChem CID 143925082) has the molecular formula C26H30F2N2O and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-[4-[(2,6-difluoro-4-phenylphenoxy)methyl]piperidin-1-yl]-N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimine.
| Compound Name | 1-[4-[(2,6-difluoro-4-phenylphenoxy)methyl]piperidin-1-yl]-N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 143925082 |
| Molecular Formula | C26H30F2N2O |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-[4-[(2,6-difluoro-4-phenylphenoxy)methyl]piperidin-1-yl]-N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C/C(=C\N=C(/C)N1CCC(COc2c(F)cc(-c3ccccc3)cc2F)CC1)CC |
| InChI | InChI=1S/C26H30F2N2O/c1-4-20(5-2)17-29-19(3)30-13-11-21(12-14-30)18-31-26-24(27)15-23(16-25(26)28)22-9-7-6-8-10-22/h4,6-10,15-17,21H,1,5,11-14,18H2,2-3H3/b20-17+,29-19+ |
| InChIKey | SIURVKJKHNMVLE-HJALPQAUSA-N |
| XLogP | 6.62 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|