C21H17N5S — CID 143925389
5-[1-(3-but-3-yn-2-yl-2-pyridinyl)pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole (PubChem CID 143925389) has the molecular formula C21H17N5S and a molecular weight of 371.47 g/mol. Its IUPAC name is 5-[1-(3-but-3-yn-2-yl-2-pyridinyl)pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 5-[1-(3-but-3-yn-2-yl-2-pyridinyl)pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 143925389 |
| Molecular Formula | C21H17N5S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 5-[1-(3-but-3-yn-2-yl-2-pyridinyl)pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole |
| SMILES | C#CC(C)c1cccnc1-n1ccc(-c2sc(-c3cccnc3)nc2C)n1 |
| InChI | InChI=1S/C21H17N5S/c1-4-14(2)17-8-6-11-23-20(17)26-12-9-18(25-26)19-15(3)24-21(27-19)16-7-5-10-22-13-16/h1,5-14H,2-3H3 |
| InChIKey | SBROIPWPDAITDO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|