C14H18N4O2 — CID 143926214
N'-[(E)-3-[(3Z)-3-ethylidene-4-iminocyclohexa-1,5-dien-1-yl]prop-2-enyl]-2-iminopropanediamide;molecular hydrogen (PubChem CID 143926214) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N'-[(E)-3-[(3Z)-3-ethylidene-4-iminocyclohexa-1,5-dien-1-yl]prop-2-enyl]-2-iminopropanediamide;molecular hydrogen.
| Compound Name | N'-[(E)-3-[(3Z)-3-ethylidene-4-iminocyclohexa-1,5-dien-1-yl]prop-2-enyl]-2-iminopropanediamide;molecular hydrogen |
|---|---|
| PubChem CID | 143926214 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N'-[(E)-3-[(3Z)-3-ethylidene-4-iminocyclohexa-1,5-dien-1-yl]prop-2-enyl]-2-iminopropanediamide;molecular hydrogen |
| SMILES | [H]/N=C(\C(N)=O)C(=O)NC/C=C/C1=CC(=C/C)/C(=N/[H])C=C1.[H][H] |
| InChI | InChI=1S/C14H16N4O2.H2/c1-2-10-8-9(5-6-11(10)15)4-3-7-18-14(20)12(16)13(17)19;/h2-6,8,15-16H,7H2,1H3,(H2,17,19)(H,18,20);1H/b4-3+,10-2-,15-11+,16-12+; |
| InChIKey | UTSQPFGVAIAOIG-BMVVGNKBSA-N |
| XLogP | 0.87 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|