C21H24F3N6OP — CID 143926537
(2S,3S)-N-[[2-(aminomethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-2-phenylphosphinan-3-amine (PubChem CID 143926537) has the molecular formula C21H24F3N6OP and a molecular weight of 464.43 g/mol. Its IUPAC name is (2S,3S)-N-[[2-(aminomethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-2-phenylphosphinan-3-amine.
| Compound Name | (2S,3S)-N-[[2-(aminomethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-2-phenylphosphinan-3-amine |
|---|---|
| PubChem CID | 143926537 |
| Molecular Formula | C21H24F3N6OP |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (2S,3S)-N-[[2-(aminomethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-2-phenylphosphinan-3-amine |
| SMILES | NCOc1ccc(-n2nnnc2C(F)(F)F)cc1CN[C@H]1CCCP[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24F3N6OP/c22-21(23,24)20-27-28-29-30(20)16-8-9-18(31-13-25)15(11-16)12-26-17-7-4-10-32-19(17)14-5-2-1-3-6-14/h1-3,5-6,8-9,11,17,19,26,32H,4,7,10,12-13,25H2/t17-,19-/m0/s1 |
| InChIKey | ZLZFSQFHCVHFLB-HKUYNNGSSA-N |
| XLogP | 3.65 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|