About 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide
4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide (PubChem CID 143926815) has the molecular formula C17H19N5O3
and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide.
Molecular Properties
| Compound Name | 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide |
| PubChem CID | 143926815 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide |
| SMILES | CCOc1nc(C=O)cc(N)c1C#N.CNNC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H9N3O2.C8H10N2O/c1-2-14-9-7(4-10)8(11)3-6(5-13)12-9;1-9-10-8(11)7-5-3-2-4-6-7/h3,5H,2H2,1H3,(H2,11,12);2-6,9H,1H3,(H,10,11) |
| InChIKey | QTYOVXFSLVGNKT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide?
The IUPAC name of 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide (CID 143926815) is 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide.
What is the SMILES notation for 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide?
The canonical SMILES for 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide is CCOc1nc(C=O)cc(N)c1C#N.CNNC(=O)c1ccccc1.
What is the InChIKey of 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide?
The InChIKey is QTYOVXFSLVGNKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2.C8H10N2O/c1-2-14-9-7(4-10)8(11)3-6(5-13)12-9;1-9-10-8(11)7-5-3-2-4-6-7/h3,5H,2H2,1H3,(H2,11,12);2-6,9H,1H3,(H,10,11).
What are the key properties of 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide?
4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide has a molecular weight of 341.37 g/mol, XLogP of 1.30, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N'-methylbenzohydrazide is sourced from PubChem (CID 143926815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).