About 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine
4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine (PubChem CID 143926929) has the molecular formula C16H21N5O2
and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine.
Molecular Properties
| Compound Name | 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine |
| PubChem CID | 143926929 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine |
| SMILES | CCOc1nc(C=O)cc(N)c1C#N.CNCCn1cccc1 |
| InChI | InChI=1S/C9H9N3O2.C7H12N2/c1-2-14-9-7(4-10)8(11)3-6(5-13)12-9;1-8-4-7-9-5-2-3-6-9/h3,5H,2H2,1H3,(H2,11,12);2-3,5-6,8H,4,7H2,1H3 |
| InChIKey | TZRVFMKLUZOLAE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine?
The IUPAC name of 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine (CID 143926929) is 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine.
What is the SMILES notation for 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine?
The canonical SMILES for 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine is CCOc1nc(C=O)cc(N)c1C#N.CNCCn1cccc1.
What is the InChIKey of 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine?
The InChIKey is TZRVFMKLUZOLAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2.C7H12N2/c1-2-14-9-7(4-10)8(11)3-6(5-13)12-9;1-8-4-7-9-5-2-3-6-9/h3,5H,2H2,1H3,(H2,11,12);2-3,5-6,8H,4,7H2,1H3.
What are the key properties of 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine?
4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine has a molecular weight of 315.38 g/mol, XLogP of 1.45, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-ethoxy-6-formylpyridine-3-carbonitrile;N-methyl-2-pyrrol-1-ylethanamine is sourced from PubChem (CID 143926929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).