C19H22N4S — CID 143927839
(2E,4E)-hepta-2,4-diene;N-methyl-5-pyridin-4-yl-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 143927839) has the molecular formula C19H22N4S and a molecular weight of 338.48 g/mol. Its IUPAC name is (2E,4E)-hepta-2,4-diene;N-methyl-5-pyridin-4-yl-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | (2E,4E)-hepta-2,4-diene;N-methyl-5-pyridin-4-yl-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 143927839 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2E,4E)-hepta-2,4-diene;N-methyl-5-pyridin-4-yl-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | C/C=C/C=C/CC.CNc1nc2ccc(-c3ccncc3)nc2s1 |
| InChI | InChI=1S/C12H10N4S.C7H12/c1-13-12-16-10-3-2-9(15-11(10)17-12)8-4-6-14-7-5-8;1-3-5-7-6-4-2/h2-7H,1H3,(H,13,16);3,5-7H,4H2,1-2H3/b;5-3+,7-6+ |
| InChIKey | GAYRWJHPTBQEEM-CMNPIJCXSA-N |
| XLogP | 5.32 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|