C18H24N4O3S — CID 143927849
ethane;formaldehyde;N-[5-[4-(hydroxyamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-2-yl]formamide (PubChem CID 143927849) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is ethane;formaldehyde;N-[5-[4-(hydroxyamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-2-yl]formamide.
| Compound Name | ethane;formaldehyde;N-[5-[4-(hydroxyamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-2-yl]formamide |
|---|---|
| PubChem CID | 143927849 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | ethane;formaldehyde;N-[5-[4-(hydroxyamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-2-yl]formamide |
| SMILES | C=O.CC.CC.O=CNc1nc2ccc(-c3ccc(NO)cc3)nc2s1 |
| InChI | InChI=1S/C13H10N4O2S.2C2H6.CH2O/c18-7-14-13-16-11-6-5-10(15-12(11)20-13)8-1-3-9(17-19)4-2-8;3*1-2/h1-7,17,19H,(H,14,16,18);2*1-2H3;1H2 |
| InChIKey | CKXNHUSHMKGGQA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|