C19H24ClFO — CID 143928423
2-chlorobutane;2-[3-fluoro-4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]propanal (PubChem CID 143928423) has the molecular formula C19H24ClFO and a molecular weight of 322.85 g/mol. Its IUPAC name is 2-chlorobutane;2-[3-fluoro-4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]propanal.
| Compound Name | 2-chlorobutane;2-[3-fluoro-4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]propanal |
|---|---|
| PubChem CID | 143928423 |
| Molecular Formula | C19H24ClFO |
| Molecular Weight | 322.85 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-chlorobutane;2-[3-fluoro-4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]propanal |
| SMILES | C=C/C=C(\C=C)c1ccc(C(C)C=O)cc1F.CCC(C)Cl |
| InChI | InChI=1S/C15H15FO.C4H9Cl/c1-4-6-12(5-2)14-8-7-13(9-15(14)16)11(3)10-17;1-3-4(2)5/h4-11H,1-2H2,3H3;4H,3H2,1-2H3/b12-6+; |
| InChIKey | ZAATVAFNDSLAGV-WXIWBVQFSA-N |
| XLogP | 5.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.85 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|