C32H37FN2O6 — CID 143928431
1-[7-hydroxy-5-[4-(2-methylcyclopropyl)butyl]-2,4-dioxo-1,4a,7,8a-tetrahydropyrano[2,3-d]pyrimidin-3-yl]ethyl 2-(3-fluoro-4-phenylphenyl)propanoate (PubChem CID 143928431) has the molecular formula C32H37FN2O6 and a molecular weight of 564.65 g/mol. Its IUPAC name is 1-[7-hydroxy-5-[4-(2-methylcyclopropyl)butyl]-2,4-dioxo-1,4a,7,8a-tetrahydropyrano[2,3-d]pyrimidin-3-yl]ethyl 2-(3-fluoro-4-phenylphenyl)propanoate.
| Compound Name | 1-[7-hydroxy-5-[4-(2-methylcyclopropyl)butyl]-2,4-dioxo-1,4a,7,8a-tetrahydropyrano[2,3-d]pyrimidin-3-yl]ethyl 2-(3-fluoro-4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 143928431 |
| Molecular Formula | C32H37FN2O6 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 1-[7-hydroxy-5-[4-(2-methylcyclopropyl)butyl]-2,4-dioxo-1,4a,7,8a-tetrahydropyrano[2,3-d]pyrimidin-3-yl]ethyl 2-(3-fluoro-4-phenylphenyl)propanoate |
| SMILES | CC(C(=O)OC(C)N1C(=O)NC2OC(O)C=C(CCCCC3CC3C)C2C1=O)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C32H37FN2O6/c1-18-15-22(18)11-7-8-12-24-17-27(36)41-29-28(24)30(37)35(32(39)34-29)20(3)40-31(38)19(2)23-13-14-25(26(33)16-23)21-9-5-4-6-10-21/h4-6,9-10,13-14,16-20,22,27-29,36H,7-8,11-12,15H2,1-3H3,(H,34,39) |
| InChIKey | XIGXUNGTJVXNSZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|