About (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde
(2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde (PubChem CID 143930136) has the molecular formula C13H15FO2
and a molecular weight of 222.26 g/mol. Its IUPAC name is (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde.
Molecular Properties
| Compound Name | (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde |
| PubChem CID | 143930136 |
| Molecular Formula | C13H15FO2 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde |
| SMILES | C/C=C/C=C1/C(=C/C=O)/CCCO/C1=C/F |
| InChI | InChI=1S/C13H15FO2/c1-2-3-6-12-11(7-8-15)5-4-9-16-13(12)10-14/h2-3,6-8,10H,4-5,9H2,1H3/b3-2+,11-7+,12-6-,13-10+ |
| InChIKey | FGRASHHGEOJNBX-WZYFQKKUSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde?
The IUPAC name of (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde (CID 143930136) is (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde.
What is the SMILES notation for (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde?
The canonical SMILES for (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde is C/C=C/C=C1/C(=C/C=O)/CCCO/C1=C/F.
What is the InChIKey of (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde?
The InChIKey is FGRASHHGEOJNBX-WZYFQKKUSA-N. The full InChI is InChI=1S/C13H15FO2/c1-2-3-6-12-11(7-8-15)5-4-9-16-13(12)10-14/h2-3,6-8,10H,4-5,9H2,1H3/b3-2+,11-7+,12-6-,13-10+.
What are the key properties of (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde?
(2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde has a molecular weight of 222.26 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(2E,3Z)-3-[(E)-but-2-enylidene]-2-(fluoromethylidene)oxepan-4-ylidene]acetaldehyde is sourced from PubChem (CID 143930136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).