C12H13F3N2 — CID 143930379
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methyl-5-(trifluoromethyl)pyrazole (PubChem CID 143930379) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methyl-5-(trifluoromethyl)pyrazole.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 143930379 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methyl-5-(trifluoromethyl)pyrazole |
| SMILES | C=C/C=C(\C=C/C)n1ncc(C)c1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2/c1-4-6-10(7-5-2)17-11(12(13,14)15)9(3)8-16-17/h4-8H,1H2,2-3H3/b7-5-,10-6+ |
| InChIKey | NQQIBVXFRPNQMS-ZPRNNRRZSA-N |
| XLogP | 3.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|