About 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane
5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane (PubChem CID 143930435) has the molecular formula C13H18ClN3OS
and a molecular weight of 299.83 g/mol. Its IUPAC name is 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane.
Molecular Properties
| Compound Name | 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane |
| PubChem CID | 143930435 |
| Molecular Formula | C13H18ClN3OS |
| Molecular Weight | 299.83 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane |
| SMILES | CCc1nc(C(N)=O)c(N)s1.CCl.c1ccccc1 |
| InChI | InChI=1S/C6H9N3OS.C6H6.CH3Cl/c1-2-3-9-4(5(7)10)6(8)11-3;1-2-4-6-5-3-1;1-2/h2,8H2,1H3,(H2,7,10);1-6H;1H3 |
| InChIKey | FAPFAGFQMSHYBA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.83 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane?
The IUPAC name of 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane (CID 143930435) is 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane.
What is the SMILES notation for 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane?
The canonical SMILES for 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane is CCc1nc(C(N)=O)c(N)s1.CCl.c1ccccc1.
What is the InChIKey of 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane?
The InChIKey is FAPFAGFQMSHYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS.C6H6.CH3Cl/c1-2-3-9-4(5(7)10)6(8)11-3;1-2-4-6-5-3-1;1-2/h2,8H2,1H3,(H2,7,10);1-6H;1H3.
What are the key properties of 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane?
5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane has a molecular weight of 299.83 g/mol, XLogP of 2.93, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-ethyl-1,3-thiazole-4-carboxamide;benzene;chloromethane is sourced from PubChem (CID 143930435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).