C26H22F2N4O2 — CID 143930582
(2Z,4Z)-2-[3-fluoro-4-[[6-(methylamino)-1H-indazol-5-yl]oxy]phenyl]-5-(4-fluoro-N-methylanilino)penta-2,4-dienal (PubChem CID 143930582) has the molecular formula C26H22F2N4O2 and a molecular weight of 460.48 g/mol. Its IUPAC name is (2Z,4Z)-2-[3-fluoro-4-[[6-(methylamino)-1H-indazol-5-yl]oxy]phenyl]-5-(4-fluoro-N-methylanilino)penta-2,4-dienal.
| Compound Name | (2Z,4Z)-2-[3-fluoro-4-[[6-(methylamino)-1H-indazol-5-yl]oxy]phenyl]-5-(4-fluoro-N-methylanilino)penta-2,4-dienal |
|---|---|
| PubChem CID | 143930582 |
| Molecular Formula | C26H22F2N4O2 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (2Z,4Z)-2-[3-fluoro-4-[[6-(methylamino)-1H-indazol-5-yl]oxy]phenyl]-5-(4-fluoro-N-methylanilino)penta-2,4-dienal |
| SMILES | CNc1cc2[nH]ncc2cc1Oc1ccc(/C(C=O)=C/C=C\N(C)c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C26H22F2N4O2/c1-29-24-14-23-19(15-30-31-23)13-26(24)34-25-10-5-17(12-22(25)28)18(16-33)4-3-11-32(2)21-8-6-20(27)7-9-21/h3-16,29H,1-2H3,(H,30,31)/b11-3-,18-4+ |
| InChIKey | SVKDCMHJMHVSPG-AZOYUULWSA-N |
| XLogP | 5.91 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|