C18H18ClN3O5S — CID 143930659
2-[5-chloro-1-(2,3-dihydro-1-benzofuran-4-ylsulfonyl)pyrrolo[3,2-b]pyridin-3-yl]ethanamine;formic acid (PubChem CID 143930659) has the molecular formula C18H18ClN3O5S and a molecular weight of 423.88 g/mol. Its IUPAC name is 2-[5-chloro-1-(2,3-dihydro-1-benzofuran-4-ylsulfonyl)pyrrolo[3,2-b]pyridin-3-yl]ethanamine;formic acid.
| Compound Name | 2-[5-chloro-1-(2,3-dihydro-1-benzofuran-4-ylsulfonyl)pyrrolo[3,2-b]pyridin-3-yl]ethanamine;formic acid |
|---|---|
| PubChem CID | 143930659 |
| Molecular Formula | C18H18ClN3O5S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 2-[5-chloro-1-(2,3-dihydro-1-benzofuran-4-ylsulfonyl)pyrrolo[3,2-b]pyridin-3-yl]ethanamine;formic acid |
| SMILES | NCCc1cn(S(=O)(=O)c2cccc3c2CCO3)c2ccc(Cl)nc12.O=CO |
| InChI | InChI=1S/C17H16ClN3O3S.CH2O2/c18-16-5-4-13-17(20-16)11(6-8-19)10-21(13)25(22,23)15-3-1-2-14-12(15)7-9-24-14;2-1-3/h1-5,10H,6-9,19H2;1H,(H,2,3) |
| InChIKey | NHFLDXSQFJTSCF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|