C16H17Cl2N — CID 143930714
2-[4-(2,6-dichloro-4-methylphenyl)butyl]pyridine (PubChem CID 143930714) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-[4-(2,6-dichloro-4-methylphenyl)butyl]pyridine.
| Compound Name | 2-[4-(2,6-dichloro-4-methylphenyl)butyl]pyridine |
|---|---|
| PubChem CID | 143930714 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[4-(2,6-dichloro-4-methylphenyl)butyl]pyridine |
| SMILES | Cc1cc(Cl)c(CCCCc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N/c1-12-10-15(17)14(16(18)11-12)8-3-2-6-13-7-4-5-9-19-13/h4-5,7,9-11H,2-3,6,8H2,1H3 |
| InChIKey | AXUCWRNVQQFVMQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|