About 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene
1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene (PubChem CID 143930729) has the molecular formula C10H14Cl2O2
and a molecular weight of 237.13 g/mol. Its IUPAC name is 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene |
| PubChem CID | 143930729 |
| Molecular Formula | C10H14Cl2O2 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene |
| SMILES | COCCOC1C(Cl)=CC(C)=CC1Cl |
| InChI | InChI=1S/C10H14Cl2O2/c1-7-5-8(11)10(9(12)6-7)14-4-3-13-2/h5-6,8,10H,3-4H2,1-2H3 |
| InChIKey | OLZUJZDTDFNZLB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene?
The IUPAC name of 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene (CID 143930729) is 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene.
What is the SMILES notation for 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene?
The canonical SMILES for 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene is COCCOC1C(Cl)=CC(C)=CC1Cl.
What is the InChIKey of 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene?
The InChIKey is OLZUJZDTDFNZLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl2O2/c1-7-5-8(11)10(9(12)6-7)14-4-3-13-2/h5-6,8,10H,3-4H2,1-2H3.
What are the key properties of 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene?
1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene has a molecular weight of 237.13 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dichloro-6-(2-methoxyethoxy)-3-methylcyclohexa-1,3-diene is sourced from PubChem (CID 143930729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).