C9H14FN — CID 143930968
(1Z,3Z,5Z)-N-ethyl-1-fluorohepta-1,3,5-trien-2-amine (PubChem CID 143930968) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is (1Z,3Z,5Z)-N-ethyl-1-fluorohepta-1,3,5-trien-2-amine.
| Compound Name | (1Z,3Z,5Z)-N-ethyl-1-fluorohepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143930968 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (1Z,3Z,5Z)-N-ethyl-1-fluorohepta-1,3,5-trien-2-amine |
| SMILES | C/C=C\C=C/C(=C/F)NCC |
| InChI | InChI=1S/C9H14FN/c1-3-5-6-7-9(8-10)11-4-2/h3,5-8,11H,4H2,1-2H3/b5-3-,7-6-,9-8- |
| InChIKey | KHZGCHOLTSOFSQ-DRAGOXMASA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|