C23H36N2O3S — CID 143931408
tert-butyl N-[3-(4-methylanilino)-3-oxo-2-thiophen-3-ylpropyl]carbamate;ethane (PubChem CID 143931408) has the molecular formula C23H36N2O3S and a molecular weight of 420.62 g/mol. Its IUPAC name is tert-butyl N-[3-(4-methylanilino)-3-oxo-2-thiophen-3-ylpropyl]carbamate;ethane.
| Compound Name | tert-butyl N-[3-(4-methylanilino)-3-oxo-2-thiophen-3-ylpropyl]carbamate;ethane |
|---|---|
| PubChem CID | 143931408 |
| Molecular Formula | C23H36N2O3S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | tert-butyl N-[3-(4-methylanilino)-3-oxo-2-thiophen-3-ylpropyl]carbamate;ethane |
| SMILES | CC.CC.Cc1ccc(NC(=O)C(CNC(=O)OC(C)(C)C)c2ccsc2)cc1 |
| InChI | InChI=1S/C19H24N2O3S.2C2H6/c1-13-5-7-15(8-6-13)21-17(22)16(14-9-10-25-12-14)11-20-18(23)24-19(2,3)4;2*1-2/h5-10,12,16H,11H2,1-4H3,(H,20,23)(H,21,22);2*1-2H3 |
| InChIKey | PDCIPKPWNAGROC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |