C26H19BrFN3O6 — CID 143931901
8-bromo-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-3,4-dihydro-1,5-naphthyridine-3-carboxylic acid (PubChem CID 143931901) has the molecular formula C26H19BrFN3O6 and a molecular weight of 568.36 g/mol. Its IUPAC name is 8-bromo-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-3,4-dihydro-1,5-naphthyridine-3-carboxylic acid.
| Compound Name | 8-bromo-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-3,4-dihydro-1,5-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 143931901 |
| Molecular Formula | C26H19BrFN3O6 |
| Molecular Weight | 568.36 g/mol |
| Exact Mass | 567.04 |
| IUPAC Name | 8-bromo-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-3,4-dihydro-1,5-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)C1C(=O)N(CCN2C(=O)c3ccccc3C2=O)c2c(ncc(Cc3ccc(F)cc3)c2Br)C1O |
| InChI | InChI=1S/C26H19BrFN3O6/c27-19-14(11-13-5-7-15(28)8-6-13)12-29-20-21(19)30(25(35)18(22(20)32)26(36)37)9-10-31-23(33)16-3-1-2-4-17(16)24(31)34/h1-8,12,18,22,32H,9-11H2,(H,36,37) |
| InChIKey | CXMBLAVWLKRXLV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|