About (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine
(Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine (PubChem CID 143932111) has the molecular formula C14H19FN2
and a molecular weight of 234.32 g/mol. Its IUPAC name is (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine |
| PubChem CID | 143932111 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine |
| SMILES | C/C=C(\C)N(C)/C=C(\NC)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2/c1-5-11(2)17(4)10-14(16-3)12-6-8-13(15)9-7-12/h5-10,16H,1-4H3/b11-5+,14-10- |
| InChIKey | PBHMBNZAOLJOEG-IFRKAEHOSA-N |
| XLogP | 3.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine?
The IUPAC name of (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine (CID 143932111) is (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine.
What is the SMILES notation for (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine?
The canonical SMILES for (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine is C/C=C(\C)N(C)/C=C(\NC)c1ccc(F)cc1.
What is the InChIKey of (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine?
The InChIKey is PBHMBNZAOLJOEG-IFRKAEHOSA-N. The full InChI is InChI=1S/C14H19FN2/c1-5-11(2)17(4)10-14(16-3)12-6-8-13(15)9-7-12/h5-10,16H,1-4H3/b11-5+,14-10-.
What are the key properties of (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine?
(Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine has a molecular weight of 234.32 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-[(E)-but-2-en-2-yl]-1-(4-fluorophenyl)-N,N'-dimethylethene-1,2-diamine is sourced from PubChem (CID 143932111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).