C12H24N2O — CID 143932223
6-(butylamino)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol (PubChem CID 143932223) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 6-(butylamino)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol.
| Compound Name | 6-(butylamino)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
|---|---|
| PubChem CID | 143932223 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 6-(butylamino)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
| SMILES | CCCCNC1CC(O)C2CCCN2C1 |
| InChI | InChI=1S/C12H24N2O/c1-2-3-6-13-10-8-12(15)11-5-4-7-14(11)9-10/h10-13,15H,2-9H2,1H3 |
| InChIKey | VKWJEYJYPWFLQS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|