C28H44N2 — CID 143932432
[2-[(E)-but-2-en-2-yl]phenyl]methanamine;2-methylbut-1-ene;(4Z,6Z)-3-methylidene-N-prop-1-en-2-ylocta-4,6-dien-1-amine (PubChem CID 143932432) has the molecular formula C28H44N2 and a molecular weight of 408.67 g/mol. Its IUPAC name is [2-[(E)-but-2-en-2-yl]phenyl]methanamine;2-methylbut-1-ene;(4Z,6Z)-3-methylidene-N-prop-1-en-2-ylocta-4,6-dien-1-amine.
| Compound Name | [2-[(E)-but-2-en-2-yl]phenyl]methanamine;2-methylbut-1-ene;(4Z,6Z)-3-methylidene-N-prop-1-en-2-ylocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 143932432 |
| Molecular Formula | C28H44N2 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | [2-[(E)-but-2-en-2-yl]phenyl]methanamine;2-methylbut-1-ene;(4Z,6Z)-3-methylidene-N-prop-1-en-2-ylocta-4,6-dien-1-amine |
| SMILES | C/C=C(\C)c1ccccc1CN.C=C(/C=C\C=C/C)CCNC(=C)C.C=C(C)CC |
| InChI | InChI=1S/C12H19N.C11H15N.C5H10/c1-5-6-7-8-12(4)9-10-13-11(2)3;1-3-9(2)11-7-5-4-6-10(11)8-12;1-4-5(2)3/h5-8,13H,2,4,9-10H2,1,3H3;3-7H,8,12H2,1-2H3;2,4H2,1,3H3/b6-5-,8-7-;9-3+; |
| InChIKey | JKTOXRONFXVMEY-PCEIWFEZSA-N |
| XLogP | 7.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|