C21H28F3N3O2 — CID 143932707
1-[3-(6-azaspiro[2.5]octan-6-yl)propyl]-4-[3-(trifluoromethoxy)phenyl]piperazin-2-one (PubChem CID 143932707) has the molecular formula C21H28F3N3O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 1-[3-(6-azaspiro[2.5]octan-6-yl)propyl]-4-[3-(trifluoromethoxy)phenyl]piperazin-2-one.
| Compound Name | 1-[3-(6-azaspiro[2.5]octan-6-yl)propyl]-4-[3-(trifluoromethoxy)phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 143932707 |
| Molecular Formula | C21H28F3N3O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-[3-(6-azaspiro[2.5]octan-6-yl)propyl]-4-[3-(trifluoromethoxy)phenyl]piperazin-2-one |
| SMILES | O=C1CN(c2cccc(OC(F)(F)F)c2)CCN1CCCN1CCC2(CC1)CC2 |
| InChI | InChI=1S/C21H28F3N3O2/c22-21(23,24)29-18-4-1-3-17(15-18)27-14-13-26(19(28)16-27)10-2-9-25-11-7-20(5-6-20)8-12-25/h1,3-4,15H,2,5-14,16H2 |
| InChIKey | GRNOBBZYBDZXSL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |