About 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane
1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane (PubChem CID 143932711) has the molecular formula C22H34ClN3O2
and a molecular weight of 407.99 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane.
Molecular Properties
| Compound Name | 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane |
| PubChem CID | 143932711 |
| Molecular Formula | C22H34ClN3O2 |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane |
| SMILES | CCN1CCC2(CC1)CC2.O=C1CCN(c2cccc(Cl)c2)CCN1CCO |
| InChI | InChI=1S/C13H17ClN2O2.C9H17N/c14-11-2-1-3-12(10-11)15-5-4-13(18)16(7-6-15)8-9-17;1-2-10-7-5-9(3-4-9)6-8-10/h1-3,10,17H,4-9H2;2-8H2,1H3 |
| InChIKey | KCOVRTRLOIZQIM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane?
The IUPAC name of 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane (CID 143932711) is 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane.
What is the SMILES notation for 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane?
The canonical SMILES for 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane is CCN1CCC2(CC1)CC2.O=C1CCN(c2cccc(Cl)c2)CCN1CCO.
What is the InChIKey of 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane?
The InChIKey is KCOVRTRLOIZQIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O2.C9H17N/c14-11-2-1-3-12(10-11)15-5-4-13(18)16(7-6-15)8-9-17;1-2-10-7-5-9(3-4-9)6-8-10/h1-3,10,17H,4-9H2;2-8H2,1H3.
What are the key properties of 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane?
1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane has a molecular weight of 407.99 g/mol, XLogP of 3.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorophenyl)-4-(2-hydroxyethyl)-1,4-diazepan-5-one;6-ethyl-6-azaspiro[2.5]octane is sourced from PubChem (CID 143932711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).