C16H27NO — CID 143933028
(3E,5Z)-3-ethenyl-N-ethyl-2,2-dimethyl-N-propylhepta-3,5-dienamide (PubChem CID 143933028) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-N-ethyl-2,2-dimethyl-N-propylhepta-3,5-dienamide.
| Compound Name | (3E,5Z)-3-ethenyl-N-ethyl-2,2-dimethyl-N-propylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 143933028 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (3E,5Z)-3-ethenyl-N-ethyl-2,2-dimethyl-N-propylhepta-3,5-dienamide |
| SMILES | C=C/C(=C\C=C/C)C(C)(C)C(=O)N(CC)CCC |
| InChI | InChI=1S/C16H27NO/c1-7-11-12-14(9-3)16(5,6)15(18)17(10-4)13-8-2/h7,9,11-12H,3,8,10,13H2,1-2,4-6H3/b11-7-,14-12+ |
| InChIKey | YIUZHPMJCGZDQC-WJDJXFINSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|