C17H29NO5 — CID 143933080
2-[[(1R,8S,9R,10S,12R)-1,9,10-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethanamine (PubChem CID 143933080) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-[[(1R,8S,9R,10S,12R)-1,9,10-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethanamine.
| Compound Name | 2-[[(1R,8S,9R,10S,12R)-1,9,10-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethanamine |
|---|---|
| PubChem CID | 143933080 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 2-[[(1R,8S,9R,10S,12R)-1,9,10-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethanamine |
| SMILES | C[C@@H]1[C@@H]2CCCC3CC[C@@]4(C)OOC32[C@@H](O4)O[C@]1(C)OCCN |
| InChI | InChI=1S/C17H29NO5/c1-11-13-6-4-5-12-7-8-15(2)20-14(17(12,13)23-22-15)21-16(11,3)19-10-9-18/h11-14H,4-10,18H2,1-3H3/t11-,12?,13+,14+,15-,16+,17?/m1/s1 |
| InChIKey | KQPYZBYDHCBETN-FZMQPQCUSA-N |
| XLogP | 2.31 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|