About [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate
[2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate (PubChem CID 143933236) has the molecular formula C21H28F2O2S
and a molecular weight of 382.52 g/mol. Its IUPAC name is [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate |
| PubChem CID | 143933236 |
| Molecular Formula | C21H28F2O2S |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate |
| SMILES | CC1CCC(CSc2ccc(OC(=O)C3CCCCC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H28F2O2S/c1-14-7-9-15(10-8-14)13-26-18-12-11-17(19(22)20(18)23)25-21(24)16-5-3-2-4-6-16/h11-12,14-16H,2-10,13H2,1H3 |
| InChIKey | JZDXMRQSFMQSDH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate?
The IUPAC name of [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate (CID 143933236) is [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate.
What is the SMILES notation for [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate?
The canonical SMILES for [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate is CC1CCC(CSc2ccc(OC(=O)C3CCCCC3)c(F)c2F)CC1.
What is the InChIKey of [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate?
The InChIKey is JZDXMRQSFMQSDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28F2O2S/c1-14-7-9-15(10-8-14)13-26-18-12-11-17(19(22)20(18)23)25-21(24)16-5-3-2-4-6-16/h11-12,14-16H,2-10,13H2,1H3.
What are the key properties of [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate?
[2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate has a molecular weight of 382.52 g/mol, XLogP of 6.37, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-difluoro-4-[(4-methylcyclohexyl)methylsulfanyl]phenyl] cyclohexanecarboxylate is sourced from PubChem (CID 143933236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).