C22H23F11N2O — CID 143933694
ethane;2-fluoro-N,3-dimethylaniline;N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]formamide (PubChem CID 143933694) has the molecular formula C22H23F11N2O and a molecular weight of 540.42 g/mol. Its IUPAC name is ethane;2-fluoro-N,3-dimethylaniline;N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]formamide.
| Compound Name | ethane;2-fluoro-N,3-dimethylaniline;N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]formamide |
|---|---|
| PubChem CID | 143933694 |
| Molecular Formula | C22H23F11N2O |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | ethane;2-fluoro-N,3-dimethylaniline;N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]formamide |
| SMILES | CC.CNc1cccc(C)c1F.Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)c1NC=O |
| InChI | InChI=1S/C12H7F10NO.C8H10FN.C2H6/c1-5-2-6(9(13,11(17,18)19)12(20,21)22)3-7(10(14,15)16)8(5)23-4-24;1-6-4-3-5-7(10-2)8(6)9;1-2/h2-4H,1H3,(H,23,24);3-5,10H,1-2H3;1-2H3 |
| InChIKey | QZHKRYLWPWEDOF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|