C25H23BrFNO2S — CID 143934346
2-(3-bromophenyl)-6-(3-fluorophenyl)-1,2,3,6-tetrahydropyridine-5-carboxylic acid;4-methylbenzenethiol (PubChem CID 143934346) has the molecular formula C25H23BrFNO2S and a molecular weight of 500.43 g/mol. Its IUPAC name is 2-(3-bromophenyl)-6-(3-fluorophenyl)-1,2,3,6-tetrahydropyridine-5-carboxylic acid;4-methylbenzenethiol.
| Compound Name | 2-(3-bromophenyl)-6-(3-fluorophenyl)-1,2,3,6-tetrahydropyridine-5-carboxylic acid;4-methylbenzenethiol |
|---|---|
| PubChem CID | 143934346 |
| Molecular Formula | C25H23BrFNO2S |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-(3-bromophenyl)-6-(3-fluorophenyl)-1,2,3,6-tetrahydropyridine-5-carboxylic acid;4-methylbenzenethiol |
| SMILES | Cc1ccc(S)cc1.O=C(O)C1=CCC(c2cccc(Br)c2)NC1c1cccc(F)c1 |
| InChI | InChI=1S/C18H15BrFNO2.C7H8S/c19-13-5-1-3-11(9-13)16-8-7-15(18(22)23)17(21-16)12-4-2-6-14(20)10-12;1-6-2-4-7(8)5-3-6/h1-7,9-10,16-17,21H,8H2,(H,22,23);2-5,8H,1H3 |
| InChIKey | MVQOLROBIZKWRT-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|