About 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one
2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one (PubChem CID 143934538) has the molecular formula C10H14Cl2N2O2
and a molecular weight of 265.14 g/mol. Its IUPAC name is 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one.
Molecular Properties
| Compound Name | 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one |
| PubChem CID | 143934538 |
| Molecular Formula | C10H14Cl2N2O2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one |
| SMILES | COC[C@H](C1CC1)N1CC(Cl)N=C(Cl)C1=O |
| InChI | InChI=1S/C10H14Cl2N2O2/c1-16-5-7(6-2-3-6)14-4-8(11)13-9(12)10(14)15/h6-8H,2-5H2,1H3/t7-,8?/m1/s1 |
| InChIKey | ZXKJDCFSHHQRSN-GVHYBUMESA-N |
| XLogP | 1.46 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one?
The IUPAC name of 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one (CID 143934538) is 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one.
What is the SMILES notation for 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one?
The canonical SMILES for 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one is COC[C@H](C1CC1)N1CC(Cl)N=C(Cl)C1=O.
What is the InChIKey of 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one?
The InChIKey is ZXKJDCFSHHQRSN-GVHYBUMESA-N. The full InChI is InChI=1S/C10H14Cl2N2O2/c1-16-5-7(6-2-3-6)14-4-8(11)13-9(12)10(14)15/h6-8H,2-5H2,1H3/t7-,8?/m1/s1.
What are the key properties of 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one?
2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one has a molecular weight of 265.14 g/mol, XLogP of 1.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3-dihydropyrazin-5-one is sourced from PubChem (CID 143934538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).