About ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine
ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 143935779) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine |
| PubChem CID | 143935779 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | CC.Cc1ncnc2cc[nH]c12 |
| InChI | InChI=1S/C7H7N3.C2H6/c1-5-7-6(2-3-8-7)10-4-9-5;1-2/h2-4,8H,1H3;1-2H3 |
| InChIKey | ZBSFBDDSZWPQGO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine (CID 143935779) is ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine is CC.Cc1ncnc2cc[nH]c12.
What is the InChIKey of ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is ZBSFBDDSZWPQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.C2H6/c1-5-7-6(2-3-8-7)10-4-9-5;1-2/h2-4,8H,1H3;1-2H3.
What are the key properties of ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine?
ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 163.22 g/mol, XLogP of 2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-5H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 143935779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).