C25H31N5O — CID 143935918
ethane;4-(5-morpholin-4-yl-2-pyrazin-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)aniline (PubChem CID 143935918) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is ethane;4-(5-morpholin-4-yl-2-pyrazin-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)aniline.
| Compound Name | ethane;4-(5-morpholin-4-yl-2-pyrazin-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)aniline |
|---|---|
| PubChem CID | 143935918 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | ethane;4-(5-morpholin-4-yl-2-pyrazin-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)aniline |
| SMILES | CC.Nc1ccc(-c2cc3c(c(N4CCOCC4)c2)CCN(c2cnccn2)C3)cc1 |
| InChI | InChI=1S/C23H25N5O.C2H6/c24-20-3-1-17(2-4-20)18-13-19-16-28(23-15-25-6-7-26-23)8-5-21(19)22(14-18)27-9-11-29-12-10-27;1-2/h1-4,6-7,13-15H,5,8-12,16,24H2;1-2H3 |
| InChIKey | PSMQDEBGAZHDCD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|