C23H30N6O2S — CID 143936074
1-[4-(7-cyclopropylsulfanyl-4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl)phenyl]-3-ethylurea (PubChem CID 143936074) has the molecular formula C23H30N6O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is 1-[4-(7-cyclopropylsulfanyl-4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl)phenyl]-3-ethylurea.
| Compound Name | 1-[4-(7-cyclopropylsulfanyl-4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl)phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 143936074 |
| Molecular Formula | C23H30N6O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 1-[4-(7-cyclopropylsulfanyl-4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl)phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(-c2nc3c(c(N4CCOCC4)n2)CCN(SC2CC2)C3)cc1 |
| InChI | InChI=1S/C23H30N6O2S/c1-2-24-23(30)25-17-5-3-16(4-6-17)21-26-20-15-29(32-18-7-8-18)10-9-19(20)22(27-21)28-11-13-31-14-12-28/h3-6,18H,2,7-15H2,1H3,(H2,24,25,30) |
| InChIKey | ILRLMKKENZUQCK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|