C25H25N3O6 — CID 143936861
[3-(2,4-dihydroxyphenyl)-2,6-dimethylpyrazolo[5,1-b][1,3]oxazol-7-yl]-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 143936861) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is [3-(2,4-dihydroxyphenyl)-2,6-dimethylpyrazolo[5,1-b][1,3]oxazol-7-yl]-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | [3-(2,4-dihydroxyphenyl)-2,6-dimethylpyrazolo[5,1-b][1,3]oxazol-7-yl]-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 143936861 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [3-(2,4-dihydroxyphenyl)-2,6-dimethylpyrazolo[5,1-b][1,3]oxazol-7-yl]-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)c1c(C)nn3c(-c4ccc(O)cc4O)c(C)oc13)CC2 |
| InChI | InChI=1S/C25H25N3O6/c1-13-22(24(31)27-8-7-15-9-20(32-3)21(33-4)10-16(15)12-27)25-28(26-13)23(14(2)34-25)18-6-5-17(29)11-19(18)30/h5-6,9-11,29-30H,7-8,12H2,1-4H3 |
| InChIKey | UGLKMKYKHCNMAO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |