C20H28N6O — CID 143937525
5-[4-(1,4-oxazepan-4-yl)cyclohexyl]-3-(1H-pyrazole-4-carboximidoyl)pyridin-2-amine (PubChem CID 143937525) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 5-[4-(1,4-oxazepan-4-yl)cyclohexyl]-3-(1H-pyrazole-4-carboximidoyl)pyridin-2-amine.
| Compound Name | 5-[4-(1,4-oxazepan-4-yl)cyclohexyl]-3-(1H-pyrazole-4-carboximidoyl)pyridin-2-amine |
|---|---|
| PubChem CID | 143937525 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 5-[4-(1,4-oxazepan-4-yl)cyclohexyl]-3-(1H-pyrazole-4-carboximidoyl)pyridin-2-amine |
| SMILES | [H]/N=C(\c1cn[nH]c1)c1cc(C2CCC(N3CCCOCC3)CC2)cnc1N |
| InChI | InChI=1S/C20H28N6O/c21-19(16-12-24-25-13-16)18-10-15(11-23-20(18)22)14-2-4-17(5-3-14)26-6-1-8-27-9-7-26/h10-14,17,21H,1-9H2,(H2,22,23)(H,24,25)/b21-19+ |
| InChIKey | RYRBQJORXVNWIL-XUTLUUPISA-N |
| XLogP | 2.55 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|