C29H34ClF2N5O2 — CID 143937694
(Z,4E)-4-[(3S,4R)-3-[5-(4-chlorophenyl)-1,4-diazocane-1-carbonyl]-4-(2,4-difluorophenyl)pyrrolidin-1-yl]-4-(dimethylhydrazinylidene)but-2-enal (PubChem CID 143937694) has the molecular formula C29H34ClF2N5O2 and a molecular weight of 558.07 g/mol. Its IUPAC name is (Z,4E)-4-[(3S,4R)-3-[5-(4-chlorophenyl)-1,4-diazocane-1-carbonyl]-4-(2,4-difluorophenyl)pyrrolidin-1-yl]-4-(dimethylhydrazinylidene)but-2-enal.
| Compound Name | (Z,4E)-4-[(3S,4R)-3-[5-(4-chlorophenyl)-1,4-diazocane-1-carbonyl]-4-(2,4-difluorophenyl)pyrrolidin-1-yl]-4-(dimethylhydrazinylidene)but-2-enal |
|---|---|
| PubChem CID | 143937694 |
| Molecular Formula | C29H34ClF2N5O2 |
| Molecular Weight | 558.07 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (Z,4E)-4-[(3S,4R)-3-[5-(4-chlorophenyl)-1,4-diazocane-1-carbonyl]-4-(2,4-difluorophenyl)pyrrolidin-1-yl]-4-(dimethylhydrazinylidene)but-2-enal |
| SMILES | CN(C)/N=C(\C=C/C=O)N1C[C@@H](C(=O)N2CCCC(c3ccc(Cl)cc3)NCC2)[C@H](c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C29H34ClF2N5O2/c1-35(2)34-28(6-4-16-38)37-18-24(23-12-11-22(31)17-26(23)32)25(19-37)29(39)36-14-3-5-27(33-13-15-36)20-7-9-21(30)10-8-20/h4,6-12,16-17,24-25,27,33H,3,5,13-15,18-19H2,1-2H3/b6-4-,34-28+/t24-,25+,27?/m0/s1 |
| InChIKey | AICFWZCFUXIFCF-ZASCQVFESA-N |
| XLogP | 4.22 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.07 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|