C30H31F2N5OS — CID 143937752
6-[(3R)-3-(2,4-difluorophenyl)-4-(4-methylsulfanyl-5-phenyl-1,4-diazocane-1-carbonyl)pyrrolidin-1-yl]pyridine-3-carbonitrile (PubChem CID 143937752) has the molecular formula C30H31F2N5OS and a molecular weight of 547.68 g/mol. Its IUPAC name is 6-[(3R)-3-(2,4-difluorophenyl)-4-(4-methylsulfanyl-5-phenyl-1,4-diazocane-1-carbonyl)pyrrolidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[(3R)-3-(2,4-difluorophenyl)-4-(4-methylsulfanyl-5-phenyl-1,4-diazocane-1-carbonyl)pyrrolidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143937752 |
| Molecular Formula | C30H31F2N5OS |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 6-[(3R)-3-(2,4-difluorophenyl)-4-(4-methylsulfanyl-5-phenyl-1,4-diazocane-1-carbonyl)pyrrolidin-1-yl]pyridine-3-carbonitrile |
| SMILES | CSN1CCN(C(=O)C2CN(c3ccc(C#N)cn3)C[C@H]2c2ccc(F)cc2F)CCCC1c1ccccc1 |
| InChI | InChI=1S/C30H31F2N5OS/c1-39-37-15-14-35(13-5-8-28(37)22-6-3-2-4-7-22)30(38)26-20-36(29-12-9-21(17-33)18-34-29)19-25(26)24-11-10-23(31)16-27(24)32/h2-4,6-7,9-12,16,18,25-26,28H,5,8,13-15,19-20H2,1H3/t25-,26?,28?/m0/s1 |
| InChIKey | AUZZPOFHXWKWDH-MRNPYCGKSA-N |
| XLogP | 5.40 |
| TPSA | 63.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|