C62H68N2 — CID 143938222
4-cyclohexa-1,3-dien-1-yl-2-N,2-N,6-N,6-N-tetrakis(3,4-diethylphenyl)-8-phenylnaphthalene-2,6-diamine (PubChem CID 143938222) has the molecular formula C62H68N2 and a molecular weight of 841.24 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-2-N,2-N,6-N,6-N-tetrakis(3,4-diethylphenyl)-8-phenylnaphthalene-2,6-diamine.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-2-N,2-N,6-N,6-N-tetrakis(3,4-diethylphenyl)-8-phenylnaphthalene-2,6-diamine |
|---|---|
| PubChem CID | 143938222 |
| Molecular Formula | C62H68N2 |
| Molecular Weight | 841.24 g/mol |
| Exact Mass | 840.54 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-2-N,2-N,6-N,6-N-tetrakis(3,4-diethylphenyl)-8-phenylnaphthalene-2,6-diamine |
| SMILES | CCc1ccc(N(c2ccc(CC)c(CC)c2)c2cc(-c3ccccc3)c3cc(N(c4ccc(CC)c(CC)c4)c4ccc(CC)c(CC)c4)cc(C4=CC=CCC4)c3c2)cc1CC |
| InChI | InChI=1S/C62H68N2/c1-9-43-27-31-53(35-47(43)13-5)63(54-32-28-44(10-2)48(14-6)36-54)57-39-59(51-23-19-17-20-24-51)62-42-58(40-60(61(62)41-57)52-25-21-18-22-26-52)64(55-33-29-45(11-3)49(15-7)37-55)56-34-30-46(12-4)50(16-8)38-56/h17-21,23-25,27-42H,9-16,22,26H2,1-8H3 |
| InChIKey | LRDPAGNXAJNIBF-UHFFFAOYSA-N |
| XLogP | 17.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.24 |
| LogP ≤ 5 | 17.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |