C33H38N2O4 — CID 143938452
5-[4-[6-(4-carboxy-4-cyanobuta-1,3-dienyl)-1,2,3,4,4a,9a-hexahydrocarbazol-9-yl]phenyl]-2,2,5-trimethylhexanoic acid (PubChem CID 143938452) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is 5-[4-[6-(4-carboxy-4-cyanobuta-1,3-dienyl)-1,2,3,4,4a,9a-hexahydrocarbazol-9-yl]phenyl]-2,2,5-trimethylhexanoic acid.
| Compound Name | 5-[4-[6-(4-carboxy-4-cyanobuta-1,3-dienyl)-1,2,3,4,4a,9a-hexahydrocarbazol-9-yl]phenyl]-2,2,5-trimethylhexanoic acid |
|---|---|
| PubChem CID | 143938452 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 5-[4-[6-(4-carboxy-4-cyanobuta-1,3-dienyl)-1,2,3,4,4a,9a-hexahydrocarbazol-9-yl]phenyl]-2,2,5-trimethylhexanoic acid |
| SMILES | CC(C)(CCC(C)(C)c1ccc(N2c3ccc(C=CC=C(C#N)C(=O)O)cc3C3CCCCC32)cc1)C(=O)O |
| InChI | InChI=1S/C33H38N2O4/c1-32(2,18-19-33(3,4)31(38)39)24-13-15-25(16-14-24)35-28-11-6-5-10-26(28)27-20-22(12-17-29(27)35)8-7-9-23(21-34)30(36)37/h7-9,12-17,20,26,28H,5-6,10-11,18-19H2,1-4H3,(H,36,37)(H,38,39) |
| InChIKey | MHTPPAVRXZDJCW-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|