C10H12BrN — CID 143938742
(2Z)-5-bromo-1,3-dimethyl-2-prop-2-enylidenepyridine (PubChem CID 143938742) has the molecular formula C10H12BrN and a molecular weight of 226.12 g/mol. Its IUPAC name is (2Z)-5-bromo-1,3-dimethyl-2-prop-2-enylidenepyridine.
| Compound Name | (2Z)-5-bromo-1,3-dimethyl-2-prop-2-enylidenepyridine |
|---|---|
| PubChem CID | 143938742 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | (2Z)-5-bromo-1,3-dimethyl-2-prop-2-enylidenepyridine |
| SMILES | C=C/C=C1/C(C)=CC(Br)=CN1C |
| InChI | InChI=1S/C10H12BrN/c1-4-5-10-8(2)6-9(11)7-12(10)3/h4-7H,1H2,2-3H3/b10-5- |
| InChIKey | FAETXGRMMRBPER-YHYXMXQVSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |