C17H20ClN5OS — CID 143938801
[(3-aminocyclohexyl)amino]-(5-chloro-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazol-2-yl)methanol (PubChem CID 143938801) has the molecular formula C17H20ClN5OS and a molecular weight of 377.90 g/mol. Its IUPAC name is [(3-aminocyclohexyl)amino]-(5-chloro-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazol-2-yl)methanol.
| Compound Name | [(3-aminocyclohexyl)amino]-(5-chloro-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 143938801 |
| Molecular Formula | C17H20ClN5OS |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [(3-aminocyclohexyl)amino]-(5-chloro-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazol-2-yl)methanol |
| SMILES | NC1CCCC(NC(O)c2nc(-c3cnn4ccccc34)c(Cl)s2)C1 |
| InChI | InChI=1S/C17H20ClN5OS/c18-15-14(12-9-20-23-7-2-1-6-13(12)23)22-17(25-15)16(24)21-11-5-3-4-10(19)8-11/h1-2,6-7,9-11,16,21,24H,3-5,8,19H2 |
| InChIKey | CGYZWXCTJGEWBQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|