C27H29NO3 — CID 143939085
(6aR)-6-(cyclohexa-1,5-dien-1-ylmethyl)-10,11-dimethoxy-2-methyl-6a,7,8,12b-tetrahydrobenzo[a]phenanthridin-5-one (PubChem CID 143939085) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is (6aR)-6-(cyclohexa-1,5-dien-1-ylmethyl)-10,11-dimethoxy-2-methyl-6a,7,8,12b-tetrahydrobenzo[a]phenanthridin-5-one.
| Compound Name | (6aR)-6-(cyclohexa-1,5-dien-1-ylmethyl)-10,11-dimethoxy-2-methyl-6a,7,8,12b-tetrahydrobenzo[a]phenanthridin-5-one |
|---|---|
| PubChem CID | 143939085 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (6aR)-6-(cyclohexa-1,5-dien-1-ylmethyl)-10,11-dimethoxy-2-methyl-6a,7,8,12b-tetrahydrobenzo[a]phenanthridin-5-one |
| SMILES | COc1cc2c(cc1OC)C1c3cc(C)ccc3C(=O)N(CC3=CCCC=C3)[C@@H]1CC2 |
| InChI | InChI=1S/C27H29NO3/c1-17-9-11-20-22(13-17)26-21-15-25(31-3)24(30-2)14-19(21)10-12-23(26)28(27(20)29)16-18-7-5-4-6-8-18/h5,7-9,11,13-15,23,26H,4,6,10,12,16H2,1-3H3/t23-,26?/m1/s1 |
| InChIKey | PBDRKYVXMVAIBP-GEPVFLLWSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |