C10H10FN — CID 143939495
3-fluoro-1-methyl-4a,8a-dihydroisoquinoline (PubChem CID 143939495) has the molecular formula C10H10FN and a molecular weight of 163.19 g/mol. Its IUPAC name is 3-fluoro-1-methyl-4a,8a-dihydroisoquinoline.
| Compound Name | 3-fluoro-1-methyl-4a,8a-dihydroisoquinoline |
|---|---|
| PubChem CID | 143939495 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 3-fluoro-1-methyl-4a,8a-dihydroisoquinoline |
| SMILES | CC1=NC(F)=CC2C=CC=CC12 |
| InChI | InChI=1S/C10H10FN/c1-7-9-5-3-2-4-8(9)6-10(11)12-7/h2-6,8-9H,1H3 |
| InChIKey | QYXZPRXHKZFJRG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|