About (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate
(4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate (PubChem CID 143939759) has the molecular formula C8H9NOS
and a molecular weight of 167.23 g/mol. Its IUPAC name is (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate.
Molecular Properties
| Compound Name | (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate |
| PubChem CID | 143939759 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate |
| SMILES | COC1=CC=C(SC#N)CC1 |
| InChI | InChI=1S/C8H9NOS/c1-10-7-2-4-8(5-3-7)11-6-9/h2,4H,3,5H2,1H3 |
| InChIKey | FAACEEJTZCYBII-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate?
The IUPAC name of (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate (CID 143939759) is (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate.
What is the SMILES notation for (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate?
The canonical SMILES for (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate is COC1=CC=C(SC#N)CC1.
What is the InChIKey of (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate?
The InChIKey is FAACEEJTZCYBII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS/c1-10-7-2-4-8(5-3-7)11-6-9/h2,4H,3,5H2,1H3.
What are the key properties of (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate?
(4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate has a molecular weight of 167.23 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycyclohexa-1,3-dien-1-yl) thiocyanate is sourced from PubChem (CID 143939759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).