C27H35F3N6O4 — CID 143939852
N-[4-(4-ethylpiperazine-1-carbonyl)phenyl]-2,4-dihydroxy-N-[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethanimidoyl]-5-propan-2-ylbenzenecarboximidamide (PubChem CID 143939852) has the molecular formula C27H35F3N6O4 and a molecular weight of 564.61 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazine-1-carbonyl)phenyl]-2,4-dihydroxy-N-[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethanimidoyl]-5-propan-2-ylbenzenecarboximidamide.
| Compound Name | N-[4-(4-ethylpiperazine-1-carbonyl)phenyl]-2,4-dihydroxy-N-[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethanimidoyl]-5-propan-2-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143939852 |
| Molecular Formula | C27H35F3N6O4 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | N-[4-(4-ethylpiperazine-1-carbonyl)phenyl]-2,4-dihydroxy-N-[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethanimidoyl]-5-propan-2-ylbenzenecarboximidamide |
| SMILES | [H]/N=C(\c1cc(C(C)C)c(O)cc1O)N(/C(=N/[H])C(O)NCC(F)(F)F)c1ccc(C(=O)N2CCN(CC)CC2)cc1 |
| InChI | InChI=1S/C27H35F3N6O4/c1-4-34-9-11-35(12-10-34)26(40)17-5-7-18(8-6-17)36(24(32)25(39)33-15-27(28,29)30)23(31)20-13-19(16(2)3)21(37)14-22(20)38/h5-8,13-14,16,25,31-33,37-39H,4,9-12,15H2,1-3H3/b31-23+,32-24+ |
| InChIKey | ZHBGMYGBJYPCIY-QBRCKEFASA-N |
| XLogP | 3.28 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|