C25H32N4O5 — CID 143939902
1-[[4-[[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-(2-oxoethanimidoyl)amino]phenyl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 143939902) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is 1-[[4-[[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-(2-oxoethanimidoyl)amino]phenyl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[[4-[[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-(2-oxoethanimidoyl)amino]phenyl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 143939902 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 1-[[4-[[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-(2-oxoethanimidoyl)amino]phenyl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | [H]/N=C(\C=O)N(c1ccc(CN2CCCC2C(=O)O)cc1)C(N)c1cc(C(C)C)c(OC)cc1O |
| InChI | InChI=1S/C25H32N4O5/c1-15(2)18-11-19(21(31)12-22(18)34-3)24(27)29(23(26)14-30)17-8-6-16(7-9-17)13-28-10-4-5-20(28)25(32)33/h6-9,11-12,14-15,20,24,26,31H,4-5,10,13,27H2,1-3H3,(H,32,33)/b26-23+ |
| InChIKey | XVAXEBQZRQSXMS-WNAAXNPUSA-N |
| XLogP | 3.21 |
| TPSA | 140.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|