C30H35N9O2 — CID 143940128
tert-butyl 7-[2-[3-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]phenyl]pyrimidin-5-yl]heptanoate (PubChem CID 143940128) has the molecular formula C30H35N9O2 and a molecular weight of 553.67 g/mol. Its IUPAC name is tert-butyl 7-[2-[3-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]phenyl]pyrimidin-5-yl]heptanoate.
| Compound Name | tert-butyl 7-[2-[3-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]phenyl]pyrimidin-5-yl]heptanoate |
|---|---|
| PubChem CID | 143940128 |
| Molecular Formula | C30H35N9O2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | tert-butyl 7-[2-[3-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]phenyl]pyrimidin-5-yl]heptanoate |
| SMILES | Cn1cc(-c2cnc3nnn(Cc4cccc(-c5ncc(CCCCCCC(=O)OC(C)(C)C)cn5)c4)c3n2)cn1 |
| InChI | InChI=1S/C30H35N9O2/c1-30(2,3)41-26(40)13-8-6-5-7-10-22-15-31-27(32-16-22)23-12-9-11-21(14-23)19-39-29-28(36-37-39)33-18-25(35-29)24-17-34-38(4)20-24/h9,11-12,14-18,20H,5-8,10,13,19H2,1-4H3 |
| InChIKey | OZCQGDNCBXDIGH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 126.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|