About acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine
acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine (PubChem CID 143940181) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine.
Molecular Properties
| Compound Name | acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine |
| PubChem CID | 143940181 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine |
| SMILES | C#C.C/C=C\C1=C(CC)CN(C)CO1.CC |
| InChI | InChI=1S/C10H17NO.C2H6.C2H2/c1-4-6-10-9(5-2)7-11(3)8-12-10;2*1-2/h4,6H,5,7-8H2,1-3H3;1-2H3;1-2H/b6-4-;; |
| InChIKey | HTCXBTIHVZGAHL-XFUGJFOESA-N |
| XLogP | 3.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine?
The IUPAC name of acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine (CID 143940181) is acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine.
What is the SMILES notation for acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine?
The canonical SMILES for acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine is C#C.C/C=C\C1=C(CC)CN(C)CO1.CC.
What is the InChIKey of acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine?
The InChIKey is HTCXBTIHVZGAHL-XFUGJFOESA-N. The full InChI is InChI=1S/C10H17NO.C2H6.C2H2/c1-4-6-10-9(5-2)7-11(3)8-12-10;2*1-2/h4,6H,5,7-8H2,1-3H3;1-2H3;1-2H/b6-4-;;.
What are the key properties of acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine?
acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine has a molecular weight of 223.36 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethane;5-ethyl-3-methyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine is sourced from PubChem (CID 143940181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).